C22H32N2O7 — CID 11144611
methyl 2-[(3S,6R)-6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-oxo-3-(phenylmethoxymethoxy)piperidin-1-yl]acetate (PubChem CID 11144611) has the molecular formula C22H32N2O7 and a molecular weight of 436.51 g/mol. Its IUPAC name is methyl 2-[(3S,6R)-6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-oxo-3-(phenylmethoxymethoxy)piperidin-1-yl]acetate.
| Compound Name | methyl 2-[(3S,6R)-6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-oxo-3-(phenylmethoxymethoxy)piperidin-1-yl]acetate |
|---|---|
| PubChem CID | 11144611 |
| Molecular Formula | C22H32N2O7 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | methyl 2-[(3S,6R)-6-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-2-oxo-3-(phenylmethoxymethoxy)piperidin-1-yl]acetate |
| SMILES | COC(=O)CN1C(=O)[C@@H](OCOCc2ccccc2)CC[C@@H]1CNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H32N2O7/c1-22(2,3)31-21(27)23-12-17-10-11-18(20(26)24(17)13-19(25)28-4)30-15-29-14-16-8-6-5-7-9-16/h5-9,17-18H,10-15H2,1-4H3,(H,23,27)/t17-,18+/m1/s1 |
| InChIKey | BENLNLVJZJLQDG-MSOLQXFVSA-N |
| XLogP | 2.23 |
| TPSA | 103.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|