C22H31NO6 — CID 102120940
[(1S)-2-oxo-3-(2-phenylmethoxyethyl)cyclohexyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate (PubChem CID 102120940) has the molecular formula C22H31NO6 and a molecular weight of 405.49 g/mol. Its IUPAC name is [(1S)-2-oxo-3-(2-phenylmethoxyethyl)cyclohexyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate.
| Compound Name | [(1S)-2-oxo-3-(2-phenylmethoxyethyl)cyclohexyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
|---|---|
| PubChem CID | 102120940 |
| Molecular Formula | C22H31NO6 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | [(1S)-2-oxo-3-(2-phenylmethoxyethyl)cyclohexyl] 2-[(2-methylpropan-2-yl)oxycarbonylamino]acetate |
| SMILES | CC(C)(C)OC(=O)NCC(=O)O[C@H]1CCCC(CCOCc2ccccc2)C1=O |
| InChI | InChI=1S/C22H31NO6/c1-22(2,3)29-21(26)23-14-19(24)28-18-11-7-10-17(20(18)25)12-13-27-15-16-8-5-4-6-9-16/h4-6,8-9,17-18H,7,10-15H2,1-3H3,(H,23,26)/t17?,18-/m0/s1 |
| InChIKey | NPSIFXDAVRFVDI-ZVAWYAOSSA-N |
| XLogP | 3.40 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|