C16H26N2O3S — CID 111447667
N-[1-[(4-hydroxy-2-methylpentyl)amino]-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide (PubChem CID 111447667) has the molecular formula C16H26N2O3S and a molecular weight of 326.46 g/mol. Its IUPAC name is N-[1-[(4-hydroxy-2-methylpentyl)amino]-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide.
| Compound Name | N-[1-[(4-hydroxy-2-methylpentyl)amino]-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111447667 |
| Molecular Formula | C16H26N2O3S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | N-[1-[(4-hydroxy-2-methylpentyl)amino]-3-methyl-1-oxobutan-2-yl]thiophene-2-carboxamide |
| SMILES | CC(O)CC(C)CNC(=O)C(NC(=O)c1cccs1)C(C)C |
| InChI | InChI=1S/C16H26N2O3S/c1-10(2)14(18-15(20)13-6-5-7-22-13)16(21)17-9-11(3)8-12(4)19/h5-7,10-12,14,19H,8-9H2,1-4H3,(H,17,21)(H,18,20) |
| InChIKey | WVTBIBPTOHBATK-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |