C16H22ClN3O — CID 111448944
2-[(5-tert-butyl-1H-pyrazol-4-yl)methylamino]-1-(2-chlorophenyl)ethanol (PubChem CID 111448944) has the molecular formula C16H22ClN3O and a molecular weight of 307.82 g/mol. Its IUPAC name is 2-[(5-tert-butyl-1H-pyrazol-4-yl)methylamino]-1-(2-chlorophenyl)ethanol.
| Compound Name | 2-[(5-tert-butyl-1H-pyrazol-4-yl)methylamino]-1-(2-chlorophenyl)ethanol |
|---|---|
| PubChem CID | 111448944 |
| Molecular Formula | C16H22ClN3O |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | 2-[(5-tert-butyl-1H-pyrazol-4-yl)methylamino]-1-(2-chlorophenyl)ethanol |
| SMILES | CC(C)(C)c1[nH]ncc1CNCC(O)c1ccccc1Cl |
| InChI | InChI=1S/C16H22ClN3O/c1-16(2,3)15-11(9-19-20-15)8-18-10-14(21)12-6-4-5-7-13(12)17/h4-7,9,14,18,21H,8,10H2,1-3H3,(H,19,20) |
| InChIKey | GXAORFBNDBGTKG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |