C15H22ClN3OS — CID 111449453
1-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-2-thiophen-3-ylpropan-2-ol (PubChem CID 111449453) has the molecular formula C15H22ClN3OS and a molecular weight of 327.88 g/mol. Its IUPAC name is 1-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-2-thiophen-3-ylpropan-2-ol.
| Compound Name | 1-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-2-thiophen-3-ylpropan-2-ol |
|---|---|
| PubChem CID | 111449453 |
| Molecular Formula | C15H22ClN3OS |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-[(5-chloro-1-methyl-3-propan-2-ylpyrazol-4-yl)methylamino]-2-thiophen-3-ylpropan-2-ol |
| SMILES | CC(C)c1nn(C)c(Cl)c1CNCC(C)(O)c1ccsc1 |
| InChI | InChI=1S/C15H22ClN3OS/c1-10(2)13-12(14(16)19(4)18-13)7-17-9-15(3,20)11-5-6-21-8-11/h5-6,8,10,17,20H,7,9H2,1-4H3 |
| InChIKey | VLMYEOQJTXDMIH-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |