C16H19ClN2O2S — CID 111450574
1-[2-(2-chlorophenyl)ethyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)urea (PubChem CID 111450574) has the molecular formula C16H19ClN2O2S and a molecular weight of 338.86 g/mol. Its IUPAC name is 1-[2-(2-chlorophenyl)ethyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)urea.
| Compound Name | 1-[2-(2-chlorophenyl)ethyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)urea |
|---|---|
| PubChem CID | 111450574 |
| Molecular Formula | C16H19ClN2O2S |
| Molecular Weight | 338.86 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | 1-[2-(2-chlorophenyl)ethyl]-3-(2-hydroxy-2-thiophen-3-ylpropyl)urea |
| SMILES | CC(O)(CNC(=O)NCCc1ccccc1Cl)c1ccsc1 |
| InChI | InChI=1S/C16H19ClN2O2S/c1-16(21,13-7-9-22-10-13)11-19-15(20)18-8-6-12-4-2-3-5-14(12)17/h2-5,7,9-10,21H,6,8,11H2,1H3,(H2,18,19,20) |
| InChIKey | VNSVADKCSQMTCS-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.86 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |