C14H14F2N4O4 — CID 111451400
N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-(4-nitropyrazol-1-yl)propanamide (PubChem CID 111451400) has the molecular formula C14H14F2N4O4 and a molecular weight of 340.29 g/mol. Its IUPAC name is N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-(4-nitropyrazol-1-yl)propanamide.
| Compound Name | N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-(4-nitropyrazol-1-yl)propanamide |
|---|---|
| PubChem CID | 111451400 |
| Molecular Formula | C14H14F2N4O4 |
| Molecular Weight | 340.29 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | N-[2-(2,6-difluorophenyl)-2-hydroxyethyl]-3-(4-nitropyrazol-1-yl)propanamide |
| SMILES | O=C(CCn1cc([N+](=O)[O-])cn1)NCC(O)c1c(F)cccc1F |
| InChI | InChI=1S/C14H14F2N4O4/c15-10-2-1-3-11(16)14(10)12(21)7-17-13(22)4-5-19-8-9(6-18-19)20(23)24/h1-3,6,8,12,21H,4-5,7H2,(H,17,22) |
| InChIKey | HZVFLSFHMLVVSV-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 110.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.29 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|