C16H17F3N4O3 — CID 97260556
3-(4-nitropyrazol-1-yl)-N-[(2S)-1,1,1-trifluoro-4-phenylbutan-2-yl]propanamide (PubChem CID 97260556) has the molecular formula C16H17F3N4O3 and a molecular weight of 370.33 g/mol. Its IUPAC name is 3-(4-nitropyrazol-1-yl)-N-[(2S)-1,1,1-trifluoro-4-phenylbutan-2-yl]propanamide.
| Compound Name | 3-(4-nitropyrazol-1-yl)-N-[(2S)-1,1,1-trifluoro-4-phenylbutan-2-yl]propanamide |
|---|---|
| PubChem CID | 97260556 |
| Molecular Formula | C16H17F3N4O3 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 3-(4-nitropyrazol-1-yl)-N-[(2S)-1,1,1-trifluoro-4-phenylbutan-2-yl]propanamide |
| SMILES | O=C(CCn1cc([N+](=O)[O-])cn1)N[C@@H](CCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H17F3N4O3/c17-16(18,19)14(7-6-12-4-2-1-3-5-12)21-15(24)8-9-22-11-13(10-20-22)23(25)26/h1-5,10-11,14H,6-9H2,(H,21,24)/t14-/m0/s1 |
| InChIKey | LJBOVGMUGGHLJC-AWEZNQCLSA-N |
| XLogP | 2.86 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|