C20H20N4O5 — CID 119245507
2-(naphthalen-2-ylmethyl)-3-[3-(4-nitropyrazol-1-yl)propanoylamino]propanoic acid (PubChem CID 119245507) has the molecular formula C20H20N4O5 and a molecular weight of 396.40 g/mol. Its IUPAC name is 2-(naphthalen-2-ylmethyl)-3-[3-(4-nitropyrazol-1-yl)propanoylamino]propanoic acid.
| Compound Name | 2-(naphthalen-2-ylmethyl)-3-[3-(4-nitropyrazol-1-yl)propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 119245507 |
| Molecular Formula | C20H20N4O5 |
| Molecular Weight | 396.40 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | 2-(naphthalen-2-ylmethyl)-3-[3-(4-nitropyrazol-1-yl)propanoylamino]propanoic acid |
| SMILES | O=C(CCn1cc([N+](=O)[O-])cn1)NCC(Cc1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C20H20N4O5/c25-19(7-8-23-13-18(12-22-23)24(28)29)21-11-17(20(26)27)10-14-5-6-15-3-1-2-4-16(15)9-14/h1-6,9,12-13,17H,7-8,10-11H2,(H,21,25)(H,26,27) |
| InChIKey | NTVARZXNYLWRAL-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 127.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|