C22H20ClN3O3S2 — CID 11145179
1-[[4-(4-chlorophenyl)sulfonylbenzoyl]amino]-3-(2-phenylethyl)thiourea (PubChem CID 11145179) has the molecular formula C22H20ClN3O3S2 and a molecular weight of 474.01 g/mol. Its IUPAC name is 1-[[4-(4-chlorophenyl)sulfonylbenzoyl]amino]-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[[4-(4-chlorophenyl)sulfonylbenzoyl]amino]-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 11145179 |
| Molecular Formula | C22H20ClN3O3S2 |
| Molecular Weight | 474.01 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | 1-[[4-(4-chlorophenyl)sulfonylbenzoyl]amino]-3-(2-phenylethyl)thiourea |
| SMILES | O=C(NNC(=S)NCCc1ccccc1)c1ccc(S(=O)(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H20ClN3O3S2/c23-18-8-12-20(13-9-18)31(28,29)19-10-6-17(7-11-19)21(27)25-26-22(30)24-15-14-16-4-2-1-3-5-16/h1-13H,14-15H2,(H,25,27)(H2,24,26,30) |
| InChIKey | HVNGJEQPTVTDHM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.01 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|