C16H23N3O2S — CID 111452270
3-tert-butyl-N-(2-hydroxy-2-thiophen-3-ylpropyl)-1-methylpyrazole-5-carboxamide (PubChem CID 111452270) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 3-tert-butyl-N-(2-hydroxy-2-thiophen-3-ylpropyl)-1-methylpyrazole-5-carboxamide.
| Compound Name | 3-tert-butyl-N-(2-hydroxy-2-thiophen-3-ylpropyl)-1-methylpyrazole-5-carboxamide |
|---|---|
| PubChem CID | 111452270 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 3-tert-butyl-N-(2-hydroxy-2-thiophen-3-ylpropyl)-1-methylpyrazole-5-carboxamide |
| SMILES | Cn1nc(C(C)(C)C)cc1C(=O)NCC(C)(O)c1ccsc1 |
| InChI | InChI=1S/C16H23N3O2S/c1-15(2,3)13-8-12(19(5)18-13)14(20)17-10-16(4,21)11-6-7-22-9-11/h6-9,21H,10H2,1-5H3,(H,17,20) |
| InChIKey | YWJMGVVCJWXGOG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |