C22H27N3O8S — CID 11145446
methyl 2-(benzylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)sulfinyloxypropanoate (PubChem CID 11145446) has the molecular formula C22H27N3O8S and a molecular weight of 493.54 g/mol. Its IUPAC name is methyl 2-(benzylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)sulfinyloxypropanoate.
| Compound Name | methyl 2-(benzylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)sulfinyloxypropanoate |
|---|---|
| PubChem CID | 11145446 |
| Molecular Formula | C22H27N3O8S |
| Molecular Weight | 493.54 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | methyl 2-(benzylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)sulfinyloxypropanoate |
| SMILES | COC(=O)C(COS(=O)c1ccc([N+](=O)[O-])cc1)(NCc1ccccc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H27N3O8S/c1-21(2,3)33-20(27)24-22(19(26)31-4,23-14-16-8-6-5-7-9-16)15-32-34(30)18-12-10-17(11-13-18)25(28)29/h5-13,23H,14-15H2,1-4H3,(H,24,27) |
| InChIKey | CTOITPVKQJZJFN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 146.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|