C15H18N2O8S — CID 11058134
methyl (E)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)sulfinyloxyprop-2-enoate (PubChem CID 11058134) has the molecular formula C15H18N2O8S and a molecular weight of 386.38 g/mol. Its IUPAC name is methyl (E)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)sulfinyloxyprop-2-enoate.
| Compound Name | methyl (E)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)sulfinyloxyprop-2-enoate |
|---|---|
| PubChem CID | 11058134 |
| Molecular Formula | C15H18N2O8S |
| Molecular Weight | 386.38 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | methyl (E)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(4-nitrophenyl)sulfinyloxyprop-2-enoate |
| SMILES | COC(=O)/C(=C\OS(=O)c1ccc([N+](=O)[O-])cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H18N2O8S/c1-15(2,3)25-14(19)16-12(13(18)23-4)9-24-26(22)11-7-5-10(6-8-11)17(20)21/h5-9H,1-4H3,(H,16,19)/b12-9+ |
| InChIKey | JDDONFJBJRMBJG-FMIVXFBMSA-N |
| XLogP | 2.17 |
| TPSA | 134.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|