C23H30N4O2 — CID 111456531
tert-butyl N-[4-[[[amino(anilino)methylidene]amino]methyl]-2-methylphenyl]-N-cyclopropylcarbamate (PubChem CID 111456531) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is tert-butyl N-[4-[[[amino(anilino)methylidene]amino]methyl]-2-methylphenyl]-N-cyclopropylcarbamate.
| Compound Name | tert-butyl N-[4-[[[amino(anilino)methylidene]amino]methyl]-2-methylphenyl]-N-cyclopropylcarbamate |
|---|---|
| PubChem CID | 111456531 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | tert-butyl N-[4-[[[amino(anilino)methylidene]amino]methyl]-2-methylphenyl]-N-cyclopropylcarbamate |
| SMILES | Cc1cc(C/N=C(\N)Nc2ccccc2)ccc1N(C(=O)OC(C)(C)C)C1CC1 |
| InChI | InChI=1S/C23H30N4O2/c1-16-14-17(15-25-21(24)26-18-8-6-5-7-9-18)10-13-20(16)27(19-11-12-19)22(28)29-23(2,3)4/h5-10,13-14,19H,11-12,15H2,1-4H3,(H3,24,25,26) |
| InChIKey | NUJXUPBOWORZPC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|