C27H45NO7Si — CID 11145791
(4R)-4-benzyl-3-[(2R,3S,4S,5R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-8-methoxy-2,4-dimethyloctanoyl]-1,3-oxazolidin-2-one (PubChem CID 11145791) has the molecular formula C27H45NO7Si and a molecular weight of 523.74 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S,4S,5R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-8-methoxy-2,4-dimethyloctanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S,4S,5R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-8-methoxy-2,4-dimethyloctanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11145791 |
| Molecular Formula | C27H45NO7Si |
| Molecular Weight | 523.74 g/mol |
| Exact Mass | 523.30 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S,4S,5R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-3,5-dihydroxy-8-methoxy-2,4-dimethyloctanoyl]-1,3-oxazolidin-2-one |
| SMILES | COC[C@@H](C[C@@H](O)[C@H](C)[C@H](O)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H45NO7Si/c1-18(23(29)15-22(17-33-6)35-36(7,8)27(3,4)5)24(30)19(2)25(31)28-21(16-34-26(28)32)14-20-12-10-9-11-13-20/h9-13,18-19,21-24,29-30H,14-17H2,1-8H3/t18-,19+,21+,22+,23+,24-/m0/s1 |
| InChIKey | FPXAOZIWZYRBPC-GGRBDDIJSA-N |
| XLogP | 4.00 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.74 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|