C27H45NO5Si — CID 10962013
(4R)-4-benzyl-3-[(2R,3S,4R,5R)-3-hydroxy-2,4-dimethyl-5-tri(propan-2-yl)silyloxyhexanoyl]-1,3-oxazolidin-2-one (PubChem CID 10962013) has the molecular formula C27H45NO5Si and a molecular weight of 491.75 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(2R,3S,4R,5R)-3-hydroxy-2,4-dimethyl-5-tri(propan-2-yl)silyloxyhexanoyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[(2R,3S,4R,5R)-3-hydroxy-2,4-dimethyl-5-tri(propan-2-yl)silyloxyhexanoyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10962013 |
| Molecular Formula | C27H45NO5Si |
| Molecular Weight | 491.75 g/mol |
| Exact Mass | 491.31 |
| IUPAC Name | (4R)-4-benzyl-3-[(2R,3S,4R,5R)-3-hydroxy-2,4-dimethyl-5-tri(propan-2-yl)silyloxyhexanoyl]-1,3-oxazolidin-2-one |
| SMILES | CC(C)[Si](O[C@H](C)[C@H](C)[C@H](O)[C@@H](C)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1)(C(C)C)C(C)C |
| InChI | InChI=1S/C27H45NO5Si/c1-17(2)34(18(3)4,19(5)6)33-22(9)20(7)25(29)21(8)26(30)28-24(16-32-27(28)31)15-23-13-11-10-12-14-23/h10-14,17-22,24-25,29H,15-16H2,1-9H3/t20-,21+,22+,24+,25-/m0/s1 |
| InChIKey | HTWCNMZJXLJISK-YQSOIZMPSA-N |
| XLogP | 5.79 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.75 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|