C13H13F3N4O2 — CID 111458949
1-(2-hydroxyethyl)-3-[1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]urea (PubChem CID 111458949) has the molecular formula C13H13F3N4O2 and a molecular weight of 314.27 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-[1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]urea.
| Compound Name | 1-(2-hydroxyethyl)-3-[1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]urea |
|---|---|
| PubChem CID | 111458949 |
| Molecular Formula | C13H13F3N4O2 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-[1-[3-(trifluoromethyl)phenyl]pyrazol-4-yl]urea |
| SMILES | O=C(NCCO)Nc1cnn(-c2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C13H13F3N4O2/c14-13(15,16)9-2-1-3-11(6-9)20-8-10(7-18-20)19-12(22)17-4-5-21/h1-3,6-8,21H,4-5H2,(H2,17,19,22) |
| InChIKey | BKSUARQBUCKPQL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |