C10H15FIN3O — CID 111465552
2-[2-(2-fluorophenoxy)propyl]guanidine;hydroiodide (PubChem CID 111465552) has the molecular formula C10H15FIN3O and a molecular weight of 339.15 g/mol. Its IUPAC name is 2-[2-(2-fluorophenoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2-fluorophenoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111465552 |
| Molecular Formula | C10H15FIN3O |
| Molecular Weight | 339.15 g/mol |
| Exact Mass | 339.02 |
| IUPAC Name | 2-[2-(2-fluorophenoxy)propyl]guanidine;hydroiodide |
| SMILES | CC(CN=C(N)N)Oc1ccccc1F.I |
| InChI | InChI=1S/C10H14FN3O.HI/c1-7(6-14-10(12)13)15-9-5-3-2-4-8(9)11;/h2-5,7H,6H2,1H3,(H4,12,13,14);1H |
| InChIKey | PGLHBIWWQDBEJD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|