C15H16ClF2NO3 — CID 111468690
1-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]-2-(furan-2-yl)propan-2-ol (PubChem CID 111468690) has the molecular formula C15H16ClF2NO3 and a molecular weight of 331.75 g/mol. Its IUPAC name is 1-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]-2-(furan-2-yl)propan-2-ol.
| Compound Name | 1-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]-2-(furan-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 111468690 |
| Molecular Formula | C15H16ClF2NO3 |
| Molecular Weight | 331.75 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 1-[[3-chloro-4-(difluoromethoxy)phenyl]methylamino]-2-(furan-2-yl)propan-2-ol |
| SMILES | CC(O)(CNCc1ccc(OC(F)F)c(Cl)c1)c1ccco1 |
| InChI | InChI=1S/C15H16ClF2NO3/c1-15(20,13-3-2-6-21-13)9-19-8-10-4-5-12(11(16)7-10)22-14(17)18/h2-7,14,19-20H,8-9H2,1H3 |
| InChIKey | UKMHVNABTFKJRL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.75 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |