C15H21F2NO2 — CID 111468790
[2-[[2-(difluoromethoxy)phenyl]methylamino]-1-methylcyclopentyl]methanol (PubChem CID 111468790) has the molecular formula C15H21F2NO2 and a molecular weight of 285.33 g/mol. Its IUPAC name is [2-[[2-(difluoromethoxy)phenyl]methylamino]-1-methylcyclopentyl]methanol.
| Compound Name | [2-[[2-(difluoromethoxy)phenyl]methylamino]-1-methylcyclopentyl]methanol |
|---|---|
| PubChem CID | 111468790 |
| Molecular Formula | C15H21F2NO2 |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | [2-[[2-(difluoromethoxy)phenyl]methylamino]-1-methylcyclopentyl]methanol |
| SMILES | CC1(CO)CCCC1NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C15H21F2NO2/c1-15(10-19)8-4-7-13(15)18-9-11-5-2-3-6-12(11)20-14(16)17/h2-3,5-6,13-14,18-19H,4,7-10H2,1H3 |
| InChIKey | UQICIGOGXSPSFL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |