C15H25N3O2 — CID 111470896
3-(2,5-dihydropyrrol-1-yl)-N-(4-hydroxycyclohexyl)pyrrolidine-1-carboxamide (PubChem CID 111470896) has the molecular formula C15H25N3O2 and a molecular weight of 279.38 g/mol. Its IUPAC name is 3-(2,5-dihydropyrrol-1-yl)-N-(4-hydroxycyclohexyl)pyrrolidine-1-carboxamide.
| Compound Name | 3-(2,5-dihydropyrrol-1-yl)-N-(4-hydroxycyclohexyl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 111470896 |
| Molecular Formula | C15H25N3O2 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.19 |
| IUPAC Name | 3-(2,5-dihydropyrrol-1-yl)-N-(4-hydroxycyclohexyl)pyrrolidine-1-carboxamide |
| SMILES | O=C(NC1CCC(O)CC1)N1CCC(N2CC=CC2)C1 |
| InChI | InChI=1S/C15H25N3O2/c19-14-5-3-12(4-6-14)16-15(20)18-10-7-13(11-18)17-8-1-2-9-17/h1-2,12-14,19H,3-11H2,(H,16,20) |
| InChIKey | AXWSLCFBAZHVSL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|