C19H26N2O4 — CID 75361439
4-(4-hydroxybenzoyl)-N-(4-hydroxycyclohexyl)piperidine-1-carboxamide (PubChem CID 75361439) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 4-(4-hydroxybenzoyl)-N-(4-hydroxycyclohexyl)piperidine-1-carboxamide.
| Compound Name | 4-(4-hydroxybenzoyl)-N-(4-hydroxycyclohexyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 75361439 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 4-(4-hydroxybenzoyl)-N-(4-hydroxycyclohexyl)piperidine-1-carboxamide |
| SMILES | O=C(c1ccc(O)cc1)C1CCN(C(=O)NC2CCC(O)CC2)CC1 |
| InChI | InChI=1S/C19H26N2O4/c22-16-5-1-13(2-6-16)18(24)14-9-11-21(12-10-14)19(25)20-15-3-7-17(23)8-4-15/h1-2,5-6,14-15,17,22-23H,3-4,7-12H2,(H,20,25) |
| InChIKey | HIWJKBHQPLVOCV-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |