C9H15N3O — CID 130666198
3-(2,5-dihydropyrrol-1-yl)pyrrolidine-1-carboxamide (PubChem CID 130666198) has the molecular formula C9H15N3O and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-(2,5-dihydropyrrol-1-yl)pyrrolidine-1-carboxamide.
| Compound Name | 3-(2,5-dihydropyrrol-1-yl)pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 130666198 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 3-(2,5-dihydropyrrol-1-yl)pyrrolidine-1-carboxamide |
| SMILES | NC(=O)N1CCC(N2CC=CC2)C1 |
| InChI | InChI=1S/C9H15N3O/c10-9(13)12-6-3-8(7-12)11-4-1-2-5-11/h1-2,8H,3-7H2,(H2,10,13) |
| InChIKey | VCEKPIHSGOHJAF-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|