C15H28N2O2 — CID 111470962
1-[2-(cyclohexen-1-yl)ethyl]-3-(4-hydroxy-2,2-dimethylbutyl)urea (PubChem CID 111470962) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is 1-[2-(cyclohexen-1-yl)ethyl]-3-(4-hydroxy-2,2-dimethylbutyl)urea.
| Compound Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(4-hydroxy-2,2-dimethylbutyl)urea |
|---|---|
| PubChem CID | 111470962 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 1-[2-(cyclohexen-1-yl)ethyl]-3-(4-hydroxy-2,2-dimethylbutyl)urea |
| SMILES | CC(C)(CCO)CNC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C15H28N2O2/c1-15(2,9-11-18)12-17-14(19)16-10-8-13-6-4-3-5-7-13/h6,18H,3-5,7-12H2,1-2H3,(H2,16,17,19) |
| InChIKey | GHSKUKIDSBXXDG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|