About 3-acetamido-3-(2,6-difluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]propanamide
3-acetamido-3-(2,6-difluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]propanamide (PubChem CID 111471088) has the molecular formula C17H22F2N2O3
and a molecular weight of 340.37 g/mol. Its IUPAC name is 3-acetamido-3-(2,6-difluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]propanamide.
Molecular Properties
| Compound Name | 3-acetamido-3-(2,6-difluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]propanamide |
| PubChem CID | 111471088 |
| Molecular Formula | C17H22F2N2O3 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 3-acetamido-3-(2,6-difluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]propanamide |
| SMILES | CC(=O)NC(CC(=O)NCC1CCCC1O)c1c(F)cccc1F |
| InChI | InChI=1S/C17H22F2N2O3/c1-10(22)21-14(17-12(18)5-3-6-13(17)19)8-16(24)20-9-11-4-2-7-15(11)23/h3,5-6,11,14-15,23H,2,4,7-9H2,1H3,(H,20,24)(H,21,22) |
| InChIKey | XUEFMWDKRRNQEH-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-acetamido-3-(2,6-difluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetamido-3-(2,6-difluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]propanamide?
The IUPAC name of 3-acetamido-3-(2,6-difluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]propanamide (CID 111471088) is 3-acetamido-3-(2,6-difluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]propanamide.
What is the SMILES notation for 3-acetamido-3-(2,6-difluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]propanamide?
The canonical SMILES for 3-acetamido-3-(2,6-difluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]propanamide is CC(=O)NC(CC(=O)NCC1CCCC1O)c1c(F)cccc1F.
What is the InChIKey of 3-acetamido-3-(2,6-difluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]propanamide?
The InChIKey is XUEFMWDKRRNQEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22F2N2O3/c1-10(22)21-14(17-12(18)5-3-6-13(17)19)8-16(24)20-9-11-4-2-7-15(11)23/h3,5-6,11,14-15,23H,2,4,7-9H2,1H3,(H,20,24)(H,21,22).
What are the key properties of 3-acetamido-3-(2,6-difluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]propanamide?
3-acetamido-3-(2,6-difluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]propanamide has a molecular weight of 340.37 g/mol, XLogP of 1.81, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetamido-3-(2,6-difluorophenyl)-N-[(2-hydroxycyclopentyl)methyl]propanamide is sourced from PubChem (CID 111471088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).