C16H17FN2O3 — CID 111475551
N-[2-fluoro-5-(furan-2-yl)phenyl]-3-hydroxypiperidine-1-carboxamide (PubChem CID 111475551) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is N-[2-fluoro-5-(furan-2-yl)phenyl]-3-hydroxypiperidine-1-carboxamide.
| Compound Name | N-[2-fluoro-5-(furan-2-yl)phenyl]-3-hydroxypiperidine-1-carboxamide |
|---|---|
| PubChem CID | 111475551 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[2-fluoro-5-(furan-2-yl)phenyl]-3-hydroxypiperidine-1-carboxamide |
| SMILES | O=C(Nc1cc(-c2ccco2)ccc1F)N1CCCC(O)C1 |
| InChI | InChI=1S/C16H17FN2O3/c17-13-6-5-11(15-4-2-8-22-15)9-14(13)18-16(21)19-7-1-3-12(20)10-19/h2,4-6,8-9,12,20H,1,3,7,10H2,(H,18,21) |
| InChIKey | JJAFEFRWZASFQH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |