C18H19FN2O4 — CID 125139865
methyl (3S)-1-[[2-fluoro-4-(furan-2-yl)phenyl]carbamoyl]piperidine-3-carboxylate (PubChem CID 125139865) has the molecular formula C18H19FN2O4 and a molecular weight of 346.36 g/mol. Its IUPAC name is methyl (3S)-1-[[2-fluoro-4-(furan-2-yl)phenyl]carbamoyl]piperidine-3-carboxylate.
| Compound Name | methyl (3S)-1-[[2-fluoro-4-(furan-2-yl)phenyl]carbamoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 125139865 |
| Molecular Formula | C18H19FN2O4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | methyl (3S)-1-[[2-fluoro-4-(furan-2-yl)phenyl]carbamoyl]piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1CCCN(C(=O)Nc2ccc(-c3ccco3)cc2F)C1 |
| InChI | InChI=1S/C18H19FN2O4/c1-24-17(22)13-4-2-8-21(11-13)18(23)20-15-7-6-12(10-14(15)19)16-5-3-9-25-16/h3,5-7,9-10,13H,2,4,8,11H2,1H3,(H,20,23)/t13-/m0/s1 |
| InChIKey | GKHPWMHOYFXHCM-ZDUSSCGKSA-N |
| XLogP | 3.50 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |