C16H21FN4O2 — CID 111477494
N-(3-ethyl-2-hydroxypentyl)-3-fluoro-4-(1,2,4-triazol-1-yl)benzamide (PubChem CID 111477494) has the molecular formula C16H21FN4O2 and a molecular weight of 320.37 g/mol. Its IUPAC name is N-(3-ethyl-2-hydroxypentyl)-3-fluoro-4-(1,2,4-triazol-1-yl)benzamide.
| Compound Name | N-(3-ethyl-2-hydroxypentyl)-3-fluoro-4-(1,2,4-triazol-1-yl)benzamide |
|---|---|
| PubChem CID | 111477494 |
| Molecular Formula | C16H21FN4O2 |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | N-(3-ethyl-2-hydroxypentyl)-3-fluoro-4-(1,2,4-triazol-1-yl)benzamide |
| SMILES | CCC(CC)C(O)CNC(=O)c1ccc(-n2cncn2)c(F)c1 |
| InChI | InChI=1S/C16H21FN4O2/c1-3-11(4-2)15(22)8-19-16(23)12-5-6-14(13(17)7-12)21-10-18-9-20-21/h5-7,9-11,15,22H,3-4,8H2,1-2H3,(H,19,23) |
| InChIKey | SRDOHCXOHAGXJB-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |