C16H23N3O3S — CID 111480767
1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]urea (PubChem CID 111480767) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]urea.
| Compound Name | 1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]urea |
|---|---|
| PubChem CID | 111480767 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 1-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]urea |
| SMILES | Cc1csc(CCCNC(=O)NCC(C)(O)c2ccc(C)o2)n1 |
| InChI | InChI=1S/C16H23N3O3S/c1-11-9-23-14(19-11)5-4-8-17-15(20)18-10-16(3,21)13-7-6-12(2)22-13/h6-7,9,21H,4-5,8,10H2,1-3H3,(H2,17,18,20) |
| InChIKey | ZAQMKIAPVUAGNH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|