C14H22N2O4 — CID 111480872
1-[2-(cyclopropylmethoxy)ethyl]-3-[2-(furan-2-yl)-2-hydroxypropyl]urea (PubChem CID 111480872) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethoxy)ethyl]-3-[2-(furan-2-yl)-2-hydroxypropyl]urea.
| Compound Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-[2-(furan-2-yl)-2-hydroxypropyl]urea |
|---|---|
| PubChem CID | 111480872 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1-[2-(cyclopropylmethoxy)ethyl]-3-[2-(furan-2-yl)-2-hydroxypropyl]urea |
| SMILES | CC(O)(CNC(=O)NCCOCC1CC1)c1ccco1 |
| InChI | InChI=1S/C14H22N2O4/c1-14(18,12-3-2-7-20-12)10-16-13(17)15-6-8-19-9-11-4-5-11/h2-3,7,11,18H,4-6,8-10H2,1H3,(H2,15,16,17) |
| InChIKey | DAWSUIAUPIAJHN-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|