C20H24N2O3 — CID 111480996
2-(7-ethyl-1H-indol-3-yl)-N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]acetamide (PubChem CID 111480996) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 2-(7-ethyl-1H-indol-3-yl)-N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]acetamide.
| Compound Name | 2-(7-ethyl-1H-indol-3-yl)-N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]acetamide |
|---|---|
| PubChem CID | 111480996 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 2-(7-ethyl-1H-indol-3-yl)-N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]acetamide |
| SMILES | CCc1cccc2c(CC(=O)NCC(C)(O)c3ccc(C)o3)c[nH]c12 |
| InChI | InChI=1S/C20H24N2O3/c1-4-14-6-5-7-16-15(11-21-19(14)16)10-18(23)22-12-20(3,24)17-9-8-13(2)25-17/h5-9,11,21,24H,4,10,12H2,1-3H3,(H,22,23) |
| InChIKey | MLQHIYRKVKGKNF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |