C13H17F3N2O3 — CID 111483054
1-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-(3,3,3-trifluoropropyl)urea (PubChem CID 111483054) has the molecular formula C13H17F3N2O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is 1-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-(3,3,3-trifluoropropyl)urea.
| Compound Name | 1-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-(3,3,3-trifluoropropyl)urea |
|---|---|
| PubChem CID | 111483054 |
| Molecular Formula | C13H17F3N2O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 1-[2-hydroxy-2-(3-methoxyphenyl)ethyl]-3-(3,3,3-trifluoropropyl)urea |
| SMILES | COc1cccc(C(O)CNC(=O)NCCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2O3/c1-21-10-4-2-3-9(7-10)11(19)8-18-12(20)17-6-5-13(14,15)16/h2-4,7,11,19H,5-6,8H2,1H3,(H2,17,18,20) |
| InChIKey | IIZPKUAZWVLJKU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |