C13H20BrNO2S — CID 111485433
3-bromo-N-(2-hydroxy-2,5-dimethylhexyl)thiophene-2-carboxamide (PubChem CID 111485433) has the molecular formula C13H20BrNO2S and a molecular weight of 334.28 g/mol. Its IUPAC name is 3-bromo-N-(2-hydroxy-2,5-dimethylhexyl)thiophene-2-carboxamide.
| Compound Name | 3-bromo-N-(2-hydroxy-2,5-dimethylhexyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 111485433 |
| Molecular Formula | C13H20BrNO2S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | 3-bromo-N-(2-hydroxy-2,5-dimethylhexyl)thiophene-2-carboxamide |
| SMILES | CC(C)CCC(C)(O)CNC(=O)c1sccc1Br |
| InChI | InChI=1S/C13H20BrNO2S/c1-9(2)4-6-13(3,17)8-15-12(16)11-10(14)5-7-18-11/h5,7,9,17H,4,6,8H2,1-3H3,(H,15,16) |
| InChIKey | XWFNWSQWNHRXAY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |