C13H11N3O — CID 11148828
2,9-dimethyl-5H-pyrido[3,2-c][1,5]naphthyridin-6-one (PubChem CID 11148828) has the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. Its IUPAC name is 2,9-dimethyl-5H-pyrido[3,2-c][1,5]naphthyridin-6-one.
| Compound Name | 2,9-dimethyl-5H-pyrido[3,2-c][1,5]naphthyridin-6-one |
|---|---|
| PubChem CID | 11148828 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2,9-dimethyl-5H-pyrido[3,2-c][1,5]naphthyridin-6-one |
| SMILES | Cc1ccc2[nH]c(=O)c3ccc(C)nc3c2n1 |
| InChI | InChI=1S/C13H11N3O/c1-7-3-5-9-11(14-7)12-10(16-13(9)17)6-4-8(2)15-12/h3-6H,1-2H3,(H,16,17) |
| InChIKey | YWNFMBCJJCFGDK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|