C15H25NO2S2 — CID 111490299
1-[methyl-(2-methylsulfanylcyclopentyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol (PubChem CID 111490299) has the molecular formula C15H25NO2S2 and a molecular weight of 315.50 g/mol. Its IUPAC name is 1-[methyl-(2-methylsulfanylcyclopentyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol.
| Compound Name | 1-[methyl-(2-methylsulfanylcyclopentyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol |
|---|---|
| PubChem CID | 111490299 |
| Molecular Formula | C15H25NO2S2 |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 1-[methyl-(2-methylsulfanylcyclopentyl)amino]-3-(thiophen-2-ylmethoxy)propan-2-ol |
| SMILES | CSC1CCCC1N(C)CC(O)COCc1cccs1 |
| InChI | InChI=1S/C15H25NO2S2/c1-16(14-6-3-7-15(14)19-2)9-12(17)10-18-11-13-5-4-8-20-13/h4-5,8,12,14-15,17H,3,6-7,9-11H2,1-2H3 |
| InChIKey | NYNBOJHWXQBDCB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |