C19H28N2O3 — CID 111490641
N-[(3-hydroxycyclohexyl)methyl]-N'-(2-methyl-6-propan-2-ylphenyl)oxamide (PubChem CID 111490641) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is N-[(3-hydroxycyclohexyl)methyl]-N'-(2-methyl-6-propan-2-ylphenyl)oxamide.
| Compound Name | N-[(3-hydroxycyclohexyl)methyl]-N'-(2-methyl-6-propan-2-ylphenyl)oxamide |
|---|---|
| PubChem CID | 111490641 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | N-[(3-hydroxycyclohexyl)methyl]-N'-(2-methyl-6-propan-2-ylphenyl)oxamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)C(=O)NCC1CCCC(O)C1 |
| InChI | InChI=1S/C19H28N2O3/c1-12(2)16-9-4-6-13(3)17(16)21-19(24)18(23)20-11-14-7-5-8-15(22)10-14/h4,6,9,12,14-15,22H,5,7-8,10-11H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | YSRSEQYVKKEPDI-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|