C22H27NO2 — CID 39885058
4-cyclopentyloxy-N-(2-methyl-6-propan-2-ylphenyl)benzamide (PubChem CID 39885058) has the molecular formula C22H27NO2 and a molecular weight of 337.46 g/mol. Its IUPAC name is 4-cyclopentyloxy-N-(2-methyl-6-propan-2-ylphenyl)benzamide.
| Compound Name | 4-cyclopentyloxy-N-(2-methyl-6-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 39885058 |
| Molecular Formula | C22H27NO2 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 4-cyclopentyloxy-N-(2-methyl-6-propan-2-ylphenyl)benzamide |
| SMILES | Cc1cccc(C(C)C)c1NC(=O)c1ccc(OC2CCCC2)cc1 |
| InChI | InChI=1S/C22H27NO2/c1-15(2)20-10-6-7-16(3)21(20)23-22(24)17-11-13-19(14-12-17)25-18-8-4-5-9-18/h6-7,10-15,18H,4-5,8-9H2,1-3H3,(H,23,24) |
| InChIKey | VYMZAPPZRROQTR-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |