C20H24N2O3 — CID 127885386
4-cyclohexyloxy-N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)benzamide (PubChem CID 127885386) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 4-cyclohexyloxy-N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)benzamide.
| Compound Name | 4-cyclohexyloxy-N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)benzamide |
|---|---|
| PubChem CID | 127885386 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 4-cyclohexyloxy-N-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)benzamide |
| SMILES | Cc1noc(C2CC2)c1NC(=O)c1ccc(OC2CCCCC2)cc1 |
| InChI | InChI=1S/C20H24N2O3/c1-13-18(19(25-22-13)14-7-8-14)21-20(23)15-9-11-17(12-10-15)24-16-5-3-2-4-6-16/h9-12,14,16H,2-8H2,1H3,(H,21,23) |
| InChIKey | ZABWGCCLEPPAMC-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |