C19H23N3O3 — CID 126772309
1-(3-cyclopentyloxyphenyl)-3-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)urea (PubChem CID 126772309) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is 1-(3-cyclopentyloxyphenyl)-3-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)urea.
| Compound Name | 1-(3-cyclopentyloxyphenyl)-3-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)urea |
|---|---|
| PubChem CID | 126772309 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 1-(3-cyclopentyloxyphenyl)-3-(5-cyclopropyl-3-methyl-1,2-oxazol-4-yl)urea |
| SMILES | Cc1noc(C2CC2)c1NC(=O)Nc1cccc(OC2CCCC2)c1 |
| InChI | InChI=1S/C19H23N3O3/c1-12-17(18(25-22-12)13-9-10-13)21-19(23)20-14-5-4-8-16(11-14)24-15-6-2-3-7-15/h4-5,8,11,13,15H,2-3,6-7,9-10H2,1H3,(H2,20,21,23) |
| InChIKey | AALOWMZQJJIBAP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |