C19H24N2O4 — CID 111490818
N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-N'-(2,4,6-trimethylphenyl)oxamide (PubChem CID 111490818) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-N'-(2,4,6-trimethylphenyl)oxamide.
| Compound Name | N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-N'-(2,4,6-trimethylphenyl)oxamide |
|---|---|
| PubChem CID | 111490818 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | N-[2-hydroxy-2-(5-methylfuran-2-yl)propyl]-N'-(2,4,6-trimethylphenyl)oxamide |
| SMILES | Cc1cc(C)c(NC(=O)C(=O)NCC(C)(O)c2ccc(C)o2)c(C)c1 |
| InChI | InChI=1S/C19H24N2O4/c1-11-8-12(2)16(13(3)9-11)21-18(23)17(22)20-10-19(5,24)15-7-6-14(4)25-15/h6-9,24H,10H2,1-5H3,(H,20,22)(H,21,23) |
| InChIKey | RYQKNWAWLVTPBR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|