C20H32N6O — CID 111492000
1-butan-2-yl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methoxyphenyl)ethyl]guanidine (PubChem CID 111492000) has the molecular formula C20H32N6O and a molecular weight of 372.52 g/mol. Its IUPAC name is 1-butan-2-yl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methoxyphenyl)ethyl]guanidine.
| Compound Name | 1-butan-2-yl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111492000 |
| Molecular Formula | C20H32N6O |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.26 |
| IUPAC Name | 1-butan-2-yl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methoxyphenyl)ethyl]guanidine |
| SMILES | CCc1nncn1CCN/C(=N\CCc1ccc(OC)cc1)NC(C)CC |
| InChI | InChI=1S/C20H32N6O/c1-5-16(3)24-20(22-13-14-26-15-23-25-19(26)6-2)21-12-11-17-7-9-18(27-4)10-8-17/h7-10,15-16H,5-6,11-14H2,1-4H3,(H2,21,22,24) |
| InChIKey | XKANKXXLXUTHKG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|