C18H26N6S — CID 111495276
N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-methylsulfanylpropyl)-2,3-dihydroindole-1-carboximidamide (PubChem CID 111495276) has the molecular formula C18H26N6S and a molecular weight of 358.52 g/mol. Its IUPAC name is N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-methylsulfanylpropyl)-2,3-dihydroindole-1-carboximidamide.
| Compound Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-methylsulfanylpropyl)-2,3-dihydroindole-1-carboximidamide |
|---|---|
| PubChem CID | 111495276 |
| Molecular Formula | C18H26N6S |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-(3-methylsulfanylpropyl)-2,3-dihydroindole-1-carboximidamide |
| SMILES | CSCCCN/C(=N\Cc1nnc(C)n1C)N1CCc2ccccc21 |
| InChI | InChI=1S/C18H26N6S/c1-14-21-22-17(23(14)2)13-20-18(19-10-6-12-25-3)24-11-9-15-7-4-5-8-16(15)24/h4-5,7-8H,6,9-13H2,1-3H3,(H,19,20) |
| InChIKey | SXJORGVSAZXJEF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|