C24H42IN5O — CID 111497584
3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111497584) has the molecular formula C24H42IN5O and a molecular weight of 543.54 g/mol. Its IUPAC name is 3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111497584 |
| Molecular Formula | C24H42IN5O |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.24 |
| IUPAC Name | 3-ethyl-1-[(2-methoxyphenyl)methyl]-1-methyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(N2CCCCC2)CCN(C)CC1)N(C)Cc1ccccc1OC.I |
| InChI | InChI=1S/C24H41N5O.HI/c1-5-25-23(28(3)19-21-11-7-8-12-22(21)30-4)26-20-24(13-17-27(2)18-14-24)29-15-9-6-10-16-29;/h7-8,11-12H,5-6,9-10,13-20H2,1-4H3,(H,25,26);1H |
| InChIKey | VIOGJXBWUPFCND-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|