C21H40IN7 — CID 111497808
3-ethyl-1-methyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111497808) has the molecular formula C21H40IN7 and a molecular weight of 517.50 g/mol. Its IUPAC name is 3-ethyl-1-methyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-1-methyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111497808 |
| Molecular Formula | C21H40IN7 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 3-ethyl-1-methyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]-1-[(1-methylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1(N2CCCCC2)CCN(C)CC1)N(C)Cc1cnn(C)c1.I |
| InChI | InChI=1S/C21H39N7.HI/c1-5-22-20(26(3)16-19-15-24-27(4)17-19)23-18-21(9-13-25(2)14-10-21)28-11-7-6-8-12-28;/h15,17H,5-14,16,18H2,1-4H3,(H,22,23);1H |
| InChIKey | PVFISUFCUBWFPH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 51.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|