C24H40FN5O — CID 111497797
3-ethyl-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine (PubChem CID 111497797) has the molecular formula C24H40FN5O and a molecular weight of 433.62 g/mol. Its IUPAC name is 3-ethyl-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine.
| Compound Name | 3-ethyl-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111497797 |
| Molecular Formula | C24H40FN5O |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.32 |
| IUPAC Name | 3-ethyl-1-[(3-fluoro-4-methoxyphenyl)methyl]-1-methyl-2-[(1-methyl-4-piperidin-1-ylpiperidin-4-yl)methyl]guanidine |
| SMILES | CCN/C(=N\CC1(N2CCCCC2)CCN(C)CC1)N(C)Cc1ccc(OC)c(F)c1 |
| InChI | InChI=1S/C24H40FN5O/c1-5-26-23(29(3)18-20-9-10-22(31-4)21(25)17-20)27-19-24(11-15-28(2)16-12-24)30-13-7-6-8-14-30/h9-10,17H,5-8,11-16,18-19H2,1-4H3,(H,26,27) |
| InChIKey | NAZIRUGPUJOVDY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 43.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|