C16H22FN5O — CID 111498902
N-tert-butyl-2-[[N-[(5-cyano-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide (PubChem CID 111498902) has the molecular formula C16H22FN5O and a molecular weight of 319.38 g/mol. Its IUPAC name is N-tert-butyl-2-[[N-[(5-cyano-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[N-[(5-cyano-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111498902 |
| Molecular Formula | C16H22FN5O |
| Molecular Weight | 319.38 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | N-tert-butyl-2-[[N-[(5-cyano-2-fluorophenyl)methyl]-N'-methylcarbamimidoyl]amino]acetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)(C)C)NCc1cc(C#N)ccc1F |
| InChI | InChI=1S/C16H22FN5O/c1-16(2,3)22-14(23)10-21-15(19-4)20-9-12-7-11(8-18)5-6-13(12)17/h5-7H,9-10H2,1-4H3,(H,22,23)(H2,19,20,21) |
| InChIKey | JINDVOBNXNQDJT-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.38 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|