C19H35F3IN5O2 — CID 111499872
2-[[ethylamino-[(1-morpholin-4-ylcyclohexyl)methylamino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide (PubChem CID 111499872) has the molecular formula C19H35F3IN5O2 and a molecular weight of 549.42 g/mol. Its IUPAC name is 2-[[ethylamino-[(1-morpholin-4-ylcyclohexyl)methylamino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[(1-morpholin-4-ylcyclohexyl)methylamino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111499872 |
| Molecular Formula | C19H35F3IN5O2 |
| Molecular Weight | 549.42 g/mol |
| Exact Mass | 549.18 |
| IUPAC Name | 2-[[ethylamino-[(1-morpholin-4-ylcyclohexyl)methylamino]methylidene]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)CC(F)(F)F)NCC1(N2CCOCC2)CCCCC1.I |
| InChI | InChI=1S/C19H34F3N5O2.HI/c1-3-23-17(24-13-16(28)26(2)15-19(20,21)22)25-14-18(7-5-4-6-8-18)27-9-11-29-12-10-27;/h3-15H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | AYYMFMMZWHGIFL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.42 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|