C19H30F3N5O — CID 111499903
2-[[N-[2-(diethylamino)-2-phenylethyl]-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 111499903) has the molecular formula C19H30F3N5O and a molecular weight of 401.48 g/mol. Its IUPAC name is 2-[[N-[2-(diethylamino)-2-phenylethyl]-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | 2-[[N-[2-(diethylamino)-2-phenylethyl]-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 111499903 |
| Molecular Formula | C19H30F3N5O |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 2-[[N-[2-(diethylamino)-2-phenylethyl]-N'-methylcarbamimidoyl]amino]-N-methyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CCN(CC)C(CN/C(=N/C)NCC(=O)N(C)CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C19H30F3N5O/c1-5-27(6-2)16(15-10-8-7-9-11-15)12-24-18(23-3)25-13-17(28)26(4)14-19(20,21)22/h7-11,16H,5-6,12-14H2,1-4H3,(H2,23,24,25) |
| InChIKey | AQXOJKXKGUWBFJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|