C14H24F3IN4O3 — CID 111500594
methyl 1-[N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide (PubChem CID 111500594) has the molecular formula C14H24F3IN4O3 and a molecular weight of 480.27 g/mol. Its IUPAC name is methyl 1-[N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide.
| Compound Name | methyl 1-[N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111500594 |
| Molecular Formula | C14H24F3IN4O3 |
| Molecular Weight | 480.27 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | methyl 1-[N'-methyl-N-[2-[methyl(2,2,2-trifluoroethyl)amino]-2-oxoethyl]carbamimidoyl]piperidine-4-carboxylate;hydroiodide |
| SMILES | C/N=C(\NCC(=O)N(C)CC(F)(F)F)N1CCC(C(=O)OC)CC1.I |
| InChI | InChI=1S/C14H23F3N4O3.HI/c1-18-13(19-8-11(22)20(2)9-14(15,16)17)21-6-4-10(5-7-21)12(23)24-3;/h10H,4-9H2,1-3H3,(H,18,19);1H |
| InChIKey | DSDHAXARKVCCQT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.27 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|