C13H15ClN2O3 — CID 11150250
2-[1-(2-chloro-5-nitrophenyl)ethyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 11150250) has the molecular formula C13H15ClN2O3 and a molecular weight of 282.73 g/mol. Its IUPAC name is 2-[1-(2-chloro-5-nitrophenyl)ethyl]-4,4-dimethyl-5H-1,3-oxazole.
| Compound Name | 2-[1-(2-chloro-5-nitrophenyl)ethyl]-4,4-dimethyl-5H-1,3-oxazole |
|---|---|
| PubChem CID | 11150250 |
| Molecular Formula | C13H15ClN2O3 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.08 |
| IUPAC Name | 2-[1-(2-chloro-5-nitrophenyl)ethyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC(C1=NC(C)(C)CO1)c1cc([N+](=O)[O-])ccc1Cl |
| InChI | InChI=1S/C13H15ClN2O3/c1-8(12-15-13(2,3)7-19-12)10-6-9(16(17)18)4-5-11(10)14/h4-6,8H,7H2,1-3H3 |
| InChIKey | BRSVJOJLZYZFNY-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|